C18H14F3NO4S — CID 33331887
N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 33331887) has the molecular formula C18H14F3NO4S and a molecular weight of 397.37 g/mol. Its IUPAC name is N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 33331887 |
| Molecular Formula | C18H14F3NO4S |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | O=S(=O)(NCC#Cc1cccc(C(F)(F)F)c1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H14F3NO4S/c19-18(20,21)14-5-1-3-13(11-14)4-2-8-22-27(23,24)15-6-7-16-17(12-15)26-10-9-25-16/h1,3,5-7,11-12,22H,8-10H2 |
| InChIKey | HXVGDLCKDQPTGX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|