C21H18F3NO3S — CID 112810737
2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide (PubChem CID 112810737) has the molecular formula C21H18F3NO3S and a molecular weight of 421.44 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide.
| Compound Name | 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide |
|---|---|
| PubChem CID | 112810737 |
| Molecular Formula | C21H18F3NO3S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide |
| SMILES | O=C(CSc1ccc2c(c1)OCCCO2)NCC#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H18F3NO3S/c22-21(23,24)16-6-1-4-15(12-16)5-2-9-25-20(26)14-29-17-7-8-18-19(13-17)28-11-3-10-27-18/h1,4,6-8,12-13H,3,9-11,14H2,(H,25,26) |
| InChIKey | JIEBSBRBYLDYEM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|