C19H15F3N4OS — CID 112811699
2-(5-cyano-2,6-dimethylpyrimidin-4-yl)sulfanyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide (PubChem CID 112811699) has the molecular formula C19H15F3N4OS and a molecular weight of 404.42 g/mol. Its IUPAC name is 2-(5-cyano-2,6-dimethylpyrimidin-4-yl)sulfanyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide.
| Compound Name | 2-(5-cyano-2,6-dimethylpyrimidin-4-yl)sulfanyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide |
|---|---|
| PubChem CID | 112811699 |
| Molecular Formula | C19H15F3N4OS |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 2-(5-cyano-2,6-dimethylpyrimidin-4-yl)sulfanyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide |
| SMILES | Cc1nc(C)c(C#N)c(SCC(=O)NCC#Cc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C19H15F3N4OS/c1-12-16(10-23)18(26-13(2)25-12)28-11-17(27)24-8-4-6-14-5-3-7-15(9-14)19(20,21)22/h3,5,7,9H,8,11H2,1-2H3,(H,24,27) |
| InChIKey | MOTKOJHWIPORIW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|