C19H13F3N2OS2 — CID 90550492
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide (PubChem CID 90550492) has the molecular formula C19H13F3N2OS2 and a molecular weight of 406.45 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide |
|---|---|
| PubChem CID | 90550492 |
| Molecular Formula | C19H13F3N2OS2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide |
| SMILES | O=C(CSc1nc2ccccc2s1)NCC#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H13F3N2OS2/c20-19(21,22)14-7-3-5-13(11-14)6-4-10-23-17(25)12-26-18-24-15-8-1-2-9-16(15)27-18/h1-3,5,7-9,11H,10,12H2,(H,23,25) |
| InChIKey | OWBQYZGJPBVVRV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|