C24H18F3NO — CID 24616941
2,2-diphenyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide (PubChem CID 24616941) has the molecular formula C24H18F3NO and a molecular weight of 393.41 g/mol. Its IUPAC name is 2,2-diphenyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide.
| Compound Name | 2,2-diphenyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide |
|---|---|
| PubChem CID | 24616941 |
| Molecular Formula | C24H18F3NO |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 2,2-diphenyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide |
| SMILES | O=C(NCC#Cc1cccc(C(F)(F)F)c1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H18F3NO/c25-24(26,27)21-15-7-9-18(17-21)10-8-16-28-23(29)22(19-11-3-1-4-12-19)20-13-5-2-6-14-20/h1-7,9,11-15,17,22H,16H2,(H,28,29) |
| InChIKey | AIKXANONHMJWJO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|