C11H7F3O2 — CID 57429633
4-[3-(trifluoromethyl)phenyl]but-3-ynoic acid (PubChem CID 57429633) has the molecular formula C11H7F3O2 and a molecular weight of 228.17 g/mol. Its IUPAC name is 4-[3-(trifluoromethyl)phenyl]but-3-ynoic acid.
| Compound Name | 4-[3-(trifluoromethyl)phenyl]but-3-ynoic acid |
|---|---|
| PubChem CID | 57429633 |
| Molecular Formula | C11H7F3O2 |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 4-[3-(trifluoromethyl)phenyl]but-3-ynoic acid |
| SMILES | O=C(O)CC#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H7F3O2/c12-11(13,14)9-5-1-3-8(7-9)4-2-6-10(15)16/h1,3,5,7H,6H2,(H,15,16) |
| InChIKey | ZSBMVABMMBQZFN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|