C14H15F3N2O2 — CID 110892280
1-(3-hydroxypropyl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea (PubChem CID 110892280) has the molecular formula C14H15F3N2O2 and a molecular weight of 300.28 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea.
| Compound Name | 1-(3-hydroxypropyl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea |
|---|---|
| PubChem CID | 110892280 |
| Molecular Formula | C14H15F3N2O2 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 1-(3-hydroxypropyl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea |
| SMILES | O=C(NCC#Cc1cccc(C(F)(F)F)c1)NCCCO |
| InChI | InChI=1S/C14H15F3N2O2/c15-14(16,17)12-6-1-4-11(10-12)5-2-7-18-13(21)19-8-3-9-20/h1,4,6,10,20H,3,7-9H2,(H2,18,19,21) |
| InChIKey | OHCHWPMOWOFJBX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|