C22H20ClF3N2O2 — CID 42937853
2-chloro-N-[3-methyl-1-oxo-1-[3-[3-(trifluoromethyl)phenyl]prop-2-ynylamino]butan-2-yl]benzamide (PubChem CID 42937853) has the molecular formula C22H20ClF3N2O2 and a molecular weight of 436.86 g/mol. Its IUPAC name is 2-chloro-N-[3-methyl-1-oxo-1-[3-[3-(trifluoromethyl)phenyl]prop-2-ynylamino]butan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[3-methyl-1-oxo-1-[3-[3-(trifluoromethyl)phenyl]prop-2-ynylamino]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 42937853 |
| Molecular Formula | C22H20ClF3N2O2 |
| Molecular Weight | 436.86 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 2-chloro-N-[3-methyl-1-oxo-1-[3-[3-(trifluoromethyl)phenyl]prop-2-ynylamino]butan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccccc1Cl)C(=O)NCC#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H20ClF3N2O2/c1-14(2)19(28-20(29)17-10-3-4-11-18(17)23)21(30)27-12-6-8-15-7-5-9-16(13-15)22(24,25)26/h3-5,7,9-11,13-14,19H,12H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | UTNSMQYAVCKAPJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.86 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|