C23H23F3N2O3 — CID 42937852
4-methoxy-N-[3-methyl-1-oxo-1-[3-[3-(trifluoromethyl)phenyl]prop-2-ynylamino]butan-2-yl]benzamide (PubChem CID 42937852) has the molecular formula C23H23F3N2O3 and a molecular weight of 432.44 g/mol. Its IUPAC name is 4-methoxy-N-[3-methyl-1-oxo-1-[3-[3-(trifluoromethyl)phenyl]prop-2-ynylamino]butan-2-yl]benzamide.
| Compound Name | 4-methoxy-N-[3-methyl-1-oxo-1-[3-[3-(trifluoromethyl)phenyl]prop-2-ynylamino]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 42937852 |
| Molecular Formula | C23H23F3N2O3 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 4-methoxy-N-[3-methyl-1-oxo-1-[3-[3-(trifluoromethyl)phenyl]prop-2-ynylamino]butan-2-yl]benzamide |
| SMILES | COc1ccc(C(=O)NC(C(=O)NCC#Cc2cccc(C(F)(F)F)c2)C(C)C)cc1 |
| InChI | InChI=1S/C23H23F3N2O3/c1-15(2)20(28-21(29)17-9-11-19(31-3)12-10-17)22(30)27-13-5-7-16-6-4-8-18(14-16)23(24,25)26/h4,6,8-12,14-15,20H,13H2,1-3H3,(H,27,30)(H,28,29) |
| InChIKey | FSNNVXXTCMNBPB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|