C18H14ClF3N2O2 — CID 90553777
1-(5-chloro-2-methoxyphenyl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea (PubChem CID 90553777) has the molecular formula C18H14ClF3N2O2 and a molecular weight of 382.77 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea |
|---|---|
| PubChem CID | 90553777 |
| Molecular Formula | C18H14ClF3N2O2 |
| Molecular Weight | 382.77 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea |
| SMILES | COc1ccc(Cl)cc1NC(=O)NCC#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H14ClF3N2O2/c1-26-16-8-7-14(19)11-15(16)24-17(25)23-9-3-5-12-4-2-6-13(10-12)18(20,21)22/h2,4,6-8,10-11H,9H2,1H3,(H2,23,24,25) |
| InChIKey | BGJZTCKXGFLTKK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.77 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|