C18H17ClN2O3 — CID 90552831
1-[3-(3-chlorophenyl)prop-2-ynyl]-3-(3,5-dimethoxyphenyl)urea (PubChem CID 90552831) has the molecular formula C18H17ClN2O3 and a molecular weight of 344.80 g/mol. Its IUPAC name is 1-[3-(3-chlorophenyl)prop-2-ynyl]-3-(3,5-dimethoxyphenyl)urea.
| Compound Name | 1-[3-(3-chlorophenyl)prop-2-ynyl]-3-(3,5-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 90552831 |
| Molecular Formula | C18H17ClN2O3 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 1-[3-(3-chlorophenyl)prop-2-ynyl]-3-(3,5-dimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)NCC#Cc2cccc(Cl)c2)cc(OC)c1 |
| InChI | InChI=1S/C18H17ClN2O3/c1-23-16-10-15(11-17(12-16)24-2)21-18(22)20-8-4-6-13-5-3-7-14(19)9-13/h3,5,7,9-12H,8H2,1-2H3,(H2,20,21,22) |
| InChIKey | VQIFFZXKLFHKLF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|