C15H14Cl2N2O3 — CID 108869520
1-(3,5-dichlorophenyl)-3-(3,5-dimethoxyphenyl)urea (PubChem CID 108869520) has the molecular formula C15H14Cl2N2O3 and a molecular weight of 341.19 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-(3,5-dimethoxyphenyl)urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-(3,5-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 108869520 |
| Molecular Formula | C15H14Cl2N2O3 |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-(3,5-dimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)Nc2cc(Cl)cc(Cl)c2)cc(OC)c1 |
| InChI | InChI=1S/C15H14Cl2N2O3/c1-21-13-6-12(7-14(8-13)22-2)19-15(20)18-11-4-9(16)3-10(17)5-11/h3-8H,1-2H3,(H2,18,19,20) |
| InChIKey | FSRBDALLOLTBDU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |