C15H16ClN3O3 — CID 108869425
1-(4-amino-3-chlorophenyl)-3-(3,5-dimethoxyphenyl)urea (PubChem CID 108869425) has the molecular formula C15H16ClN3O3 and a molecular weight of 321.76 g/mol. Its IUPAC name is 1-(4-amino-3-chlorophenyl)-3-(3,5-dimethoxyphenyl)urea.
| Compound Name | 1-(4-amino-3-chlorophenyl)-3-(3,5-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 108869425 |
| Molecular Formula | C15H16ClN3O3 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 1-(4-amino-3-chlorophenyl)-3-(3,5-dimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)Nc2ccc(N)c(Cl)c2)cc(OC)c1 |
| InChI | InChI=1S/C15H16ClN3O3/c1-21-11-5-10(6-12(8-11)22-2)19-15(20)18-9-3-4-14(17)13(16)7-9/h3-8H,17H2,1-2H3,(H2,18,19,20) |
| InChIKey | HLXDDLSLQXHHOS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|