C13H10Cl3N3O — CID 82861443
1-(4-amino-3-chlorophenyl)-3-(2,5-dichlorophenyl)urea (PubChem CID 82861443) has the molecular formula C13H10Cl3N3O and a molecular weight of 330.60 g/mol. Its IUPAC name is 1-(4-amino-3-chlorophenyl)-3-(2,5-dichlorophenyl)urea.
| Compound Name | 1-(4-amino-3-chlorophenyl)-3-(2,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 82861443 |
| Molecular Formula | C13H10Cl3N3O |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 1-(4-amino-3-chlorophenyl)-3-(2,5-dichlorophenyl)urea |
| SMILES | Nc1ccc(NC(=O)Nc2cc(Cl)ccc2Cl)cc1Cl |
| InChI | InChI=1S/C13H10Cl3N3O/c14-7-1-3-9(15)12(5-7)19-13(20)18-8-2-4-11(17)10(16)6-8/h1-6H,17H2,(H2,18,19,20) |
| InChIKey | OINVMIZVNLOVFJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|