C13H11Cl2N3O2 — CID 107698053
1-(2-amino-4-hydroxyphenyl)-3-(3,4-dichlorophenyl)urea (PubChem CID 107698053) has the molecular formula C13H11Cl2N3O2 and a molecular weight of 312.16 g/mol. Its IUPAC name is 1-(2-amino-4-hydroxyphenyl)-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-(2-amino-4-hydroxyphenyl)-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 107698053 |
| Molecular Formula | C13H11Cl2N3O2 |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 1-(2-amino-4-hydroxyphenyl)-3-(3,4-dichlorophenyl)urea |
| SMILES | Nc1cc(O)ccc1NC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H11Cl2N3O2/c14-9-3-1-7(5-10(9)15)17-13(20)18-12-4-2-8(19)6-11(12)16/h1-6,19H,16H2,(H2,17,18,20) |
| InChIKey | FFRQIOQRXLHKNM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|