C15H15Cl2N3O — CID 43551526
1-(3-amino-4-ethylphenyl)-3-(3,4-dichlorophenyl)urea (PubChem CID 43551526) has the molecular formula C15H15Cl2N3O and a molecular weight of 324.21 g/mol. Its IUPAC name is 1-(3-amino-4-ethylphenyl)-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-(3-amino-4-ethylphenyl)-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 43551526 |
| Molecular Formula | C15H15Cl2N3O |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 1-(3-amino-4-ethylphenyl)-3-(3,4-dichlorophenyl)urea |
| SMILES | CCc1ccc(NC(=O)Nc2ccc(Cl)c(Cl)c2)cc1N |
| InChI | InChI=1S/C15H15Cl2N3O/c1-2-9-3-4-11(8-14(9)18)20-15(21)19-10-5-6-12(16)13(17)7-10/h3-8H,2,18H2,1H3,(H2,19,20,21) |
| InChIKey | BFSWPGKPXLHOGA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|