C12H12Cl2N4O — CID 104620378
1-(3,4-dichlorophenyl)-3-(5-ethyl-1H-pyrazol-3-yl)urea (PubChem CID 104620378) has the molecular formula C12H12Cl2N4O and a molecular weight of 299.16 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(5-ethyl-1H-pyrazol-3-yl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(5-ethyl-1H-pyrazol-3-yl)urea |
|---|---|
| PubChem CID | 104620378 |
| Molecular Formula | C12H12Cl2N4O |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(5-ethyl-1H-pyrazol-3-yl)urea |
| SMILES | CCc1cc(NC(=O)Nc2ccc(Cl)c(Cl)c2)n[nH]1 |
| InChI | InChI=1S/C12H12Cl2N4O/c1-2-7-6-11(18-17-7)16-12(19)15-8-3-4-9(13)10(14)5-8/h3-6H,2H2,1H3,(H3,15,16,17,18,19) |
| InChIKey | MJMRFAOUKWNHKU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |