C12H11Cl2N3O — CID 113433751
2,6-dichloro-N-(5-ethyl-1H-pyrazol-3-yl)benzamide (PubChem CID 113433751) has the molecular formula C12H11Cl2N3O and a molecular weight of 284.15 g/mol. Its IUPAC name is 2,6-dichloro-N-(5-ethyl-1H-pyrazol-3-yl)benzamide.
| Compound Name | 2,6-dichloro-N-(5-ethyl-1H-pyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 113433751 |
| Molecular Formula | C12H11Cl2N3O |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 2,6-dichloro-N-(5-ethyl-1H-pyrazol-3-yl)benzamide |
| SMILES | CCc1cc(NC(=O)c2c(Cl)cccc2Cl)n[nH]1 |
| InChI | InChI=1S/C12H11Cl2N3O/c1-2-7-6-10(17-16-7)15-12(18)11-8(13)4-3-5-9(11)14/h3-6H,2H2,1H3,(H2,15,16,17,18) |
| InChIKey | VDBHPQQORWRRIJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |