C13H10Cl2N2O2 — CID 639709
1-(3,4-dichlorophenyl)-3-(4-hydroxyphenyl)urea (PubChem CID 639709) has the molecular formula C13H10Cl2N2O2 and a molecular weight of 297.14 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(4-hydroxyphenyl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(4-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 639709 |
| Molecular Formula | C13H10Cl2N2O2 |
| Molecular Weight | 297.14 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(4-hydroxyphenyl)urea |
| SMILES | O=C(Nc1ccc(O)cc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H10Cl2N2O2/c14-11-6-3-9(7-12(11)15)17-13(19)16-8-1-4-10(18)5-2-8/h1-7,18H,(H2,16,17,19) |
| InChIKey | ZBEMPBNOSDYHQH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.14 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|