C8H7Cl2NOS — CID 23273770
S-methyl N-(3,4-dichlorophenyl)carbamothioate (PubChem CID 23273770) has the molecular formula C8H7Cl2NOS and a molecular weight of 236.12 g/mol. Its IUPAC name is S-methyl N-(3,4-dichlorophenyl)carbamothioate.
| Compound Name | S-methyl N-(3,4-dichlorophenyl)carbamothioate |
|---|---|
| PubChem CID | 23273770 |
| Molecular Formula | C8H7Cl2NOS |
| Molecular Weight | 236.12 g/mol |
| Exact Mass | 234.96 |
| IUPAC Name | S-methyl N-(3,4-dichlorophenyl)carbamothioate |
| SMILES | CSC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H7Cl2NOS/c1-13-8(12)11-5-2-3-6(9)7(10)4-5/h2-4H,1H3,(H,11,12) |
| InChIKey | IINRGGXSLAOMKK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.12 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|