C9H11Cl2N3O — CID 12537925
3-(3,4-dichlorophenyl)-1-methyl-1-(methylamino)urea (PubChem CID 12537925) has the molecular formula C9H11Cl2N3O and a molecular weight of 248.11 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-methyl-1-(methylamino)urea.
| Compound Name | 3-(3,4-dichlorophenyl)-1-methyl-1-(methylamino)urea |
|---|---|
| PubChem CID | 12537925 |
| Molecular Formula | C9H11Cl2N3O |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-methyl-1-(methylamino)urea |
| SMILES | CNN(C)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H11Cl2N3O/c1-12-14(2)9(15)13-6-3-4-7(10)8(11)5-6/h3-5,12H,1-2H3,(H,13,15) |
| InChIKey | HKPXWYDRAHOWJK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|