C11H14Cl2N2OS2 — CID 54418055
3-(3,4-dichlorophenyl)-1-methyl-1-(propyldisulfanyl)urea (PubChem CID 54418055) has the molecular formula C11H14Cl2N2OS2 and a molecular weight of 325.29 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-methyl-1-(propyldisulfanyl)urea.
| Compound Name | 3-(3,4-dichlorophenyl)-1-methyl-1-(propyldisulfanyl)urea |
|---|---|
| PubChem CID | 54418055 |
| Molecular Formula | C11H14Cl2N2OS2 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-methyl-1-(propyldisulfanyl)urea |
| SMILES | CCCSSN(C)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2N2OS2/c1-3-6-17-18-15(2)11(16)14-8-4-5-9(12)10(13)7-8/h4-5,7H,3,6H2,1-2H3,(H,14,16) |
| InChIKey | VYVGTWIRWNIILM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|