C12H13Cl5N2OS — CID 12906047
3-(3,4-dichlorophenyl)-1-methyl-1-(2,2,2-trichloro-1-ethylsulfanylethyl)urea (PubChem CID 12906047) has the molecular formula C12H13Cl5N2OS and a molecular weight of 410.58 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-methyl-1-(2,2,2-trichloro-1-ethylsulfanylethyl)urea.
| Compound Name | 3-(3,4-dichlorophenyl)-1-methyl-1-(2,2,2-trichloro-1-ethylsulfanylethyl)urea |
|---|---|
| PubChem CID | 12906047 |
| Molecular Formula | C12H13Cl5N2OS |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 407.92 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-methyl-1-(2,2,2-trichloro-1-ethylsulfanylethyl)urea |
| SMILES | CCSC(N(C)C(=O)Nc1ccc(Cl)c(Cl)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H13Cl5N2OS/c1-3-21-10(12(15,16)17)19(2)11(20)18-7-4-5-8(13)9(14)6-7/h4-6,10H,3H2,1-2H3,(H,18,20) |
| InChIKey | JVJSSAUZOCXWSP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|