C13H18Cl2N2O — CID 108866426
1-tert-butyl-3-(3,4-dichlorophenyl)-1-ethylurea (PubChem CID 108866426) has the molecular formula C13H18Cl2N2O and a molecular weight of 289.21 g/mol. Its IUPAC name is 1-tert-butyl-3-(3,4-dichlorophenyl)-1-ethylurea.
| Compound Name | 1-tert-butyl-3-(3,4-dichlorophenyl)-1-ethylurea |
|---|---|
| PubChem CID | 108866426 |
| Molecular Formula | C13H18Cl2N2O |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 1-tert-butyl-3-(3,4-dichlorophenyl)-1-ethylurea |
| SMILES | CCN(C(=O)Nc1ccc(Cl)c(Cl)c1)C(C)(C)C |
| InChI | InChI=1S/C13H18Cl2N2O/c1-5-17(13(2,3)4)12(18)16-9-6-7-10(14)11(15)8-9/h6-8H,5H2,1-4H3,(H,16,18) |
| InChIKey | ABMCINORBGFNSA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |