C12H16Cl2N2O3S — CID 21414083
1-tert-butylsulfonyl-3-(3,4-dichlorophenyl)-1-methylurea (PubChem CID 21414083) has the molecular formula C12H16Cl2N2O3S and a molecular weight of 339.24 g/mol. Its IUPAC name is 1-tert-butylsulfonyl-3-(3,4-dichlorophenyl)-1-methylurea.
| Compound Name | 1-tert-butylsulfonyl-3-(3,4-dichlorophenyl)-1-methylurea |
|---|---|
| PubChem CID | 21414083 |
| Molecular Formula | C12H16Cl2N2O3S |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 1-tert-butylsulfonyl-3-(3,4-dichlorophenyl)-1-methylurea |
| SMILES | CN(C(=O)Nc1ccc(Cl)c(Cl)c1)S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C12H16Cl2N2O3S/c1-12(2,3)20(18,19)16(4)11(17)15-8-5-6-9(13)10(14)7-8/h5-7H,1-4H3,(H,15,17) |
| InChIKey | ADYPXNDLKPQMLC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |