C11H13Cl2N3O2 — CID 12876090
1-[(3,4-dichlorophenyl)carbamoyl]-1,3,3-trimethylurea (PubChem CID 12876090) has the molecular formula C11H13Cl2N3O2 and a molecular weight of 290.15 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)carbamoyl]-1,3,3-trimethylurea.
| Compound Name | 1-[(3,4-dichlorophenyl)carbamoyl]-1,3,3-trimethylurea |
|---|---|
| PubChem CID | 12876090 |
| Molecular Formula | C11H13Cl2N3O2 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)carbamoyl]-1,3,3-trimethylurea |
| SMILES | CN(C)C(=O)N(C)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H13Cl2N3O2/c1-15(2)11(18)16(3)10(17)14-7-4-5-8(12)9(13)6-7/h4-6H,1-3H3,(H,14,17) |
| InChIKey | MWLYSBLTNDCVIV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |