C13H18Cl2N2O2 — CID 20788075
3-(3,4-dichlorophenyl)-1-(2-hydroxypropyl)-1-propylurea (PubChem CID 20788075) has the molecular formula C13H18Cl2N2O2 and a molecular weight of 305.20 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-(2-hydroxypropyl)-1-propylurea.
| Compound Name | 3-(3,4-dichlorophenyl)-1-(2-hydroxypropyl)-1-propylurea |
|---|---|
| PubChem CID | 20788075 |
| Molecular Formula | C13H18Cl2N2O2 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-(2-hydroxypropyl)-1-propylurea |
| SMILES | CCCN(CC(C)O)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H18Cl2N2O2/c1-3-6-17(8-9(2)18)13(19)16-10-4-5-11(14)12(15)7-10/h4-5,7,9,18H,3,6,8H2,1-2H3,(H,16,19) |
| InChIKey | SSXDUPPVZCWVKC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |