C12H16Cl2N2O — CID 47278262
3-(3,4-dichlorophenyl)-1-methyl-1-(2-methylpropyl)urea (PubChem CID 47278262) has the molecular formula C12H16Cl2N2O and a molecular weight of 275.18 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-methyl-1-(2-methylpropyl)urea.
| Compound Name | 3-(3,4-dichlorophenyl)-1-methyl-1-(2-methylpropyl)urea |
|---|---|
| PubChem CID | 47278262 |
| Molecular Formula | C12H16Cl2N2O |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-methyl-1-(2-methylpropyl)urea |
| SMILES | CC(C)CN(C)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H16Cl2N2O/c1-8(2)7-16(3)12(17)15-9-4-5-10(13)11(14)6-9/h4-6,8H,7H2,1-3H3,(H,15,17) |
| InChIKey | RMJNHVIWDLDIFX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |