C11H13BrCl2N2O — CID 106441536
1-(3-bromopropyl)-3-(3,4-dichlorophenyl)-1-methylurea (PubChem CID 106441536) has the molecular formula C11H13BrCl2N2O and a molecular weight of 340.05 g/mol. Its IUPAC name is 1-(3-bromopropyl)-3-(3,4-dichlorophenyl)-1-methylurea.
| Compound Name | 1-(3-bromopropyl)-3-(3,4-dichlorophenyl)-1-methylurea |
|---|---|
| PubChem CID | 106441536 |
| Molecular Formula | C11H13BrCl2N2O |
| Molecular Weight | 340.05 g/mol |
| Exact Mass | 337.96 |
| IUPAC Name | 1-(3-bromopropyl)-3-(3,4-dichlorophenyl)-1-methylurea |
| SMILES | CN(CCCBr)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H13BrCl2N2O/c1-16(6-2-5-12)11(17)15-8-3-4-9(13)10(14)7-8/h3-4,7H,2,5-6H2,1H3,(H,15,17) |
| InChIKey | NOQMGNXMDSKBAG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.05 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|