C12H18Cl2N4O2 — CID 175137173
3-(3,4-dichlorophenyl)-1,1-dimethylurea;1,1-dimethylurea (PubChem CID 175137173) has the molecular formula C12H18Cl2N4O2 and a molecular weight of 321.21 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1,1-dimethylurea;1,1-dimethylurea.
| Compound Name | 3-(3,4-dichlorophenyl)-1,1-dimethylurea;1,1-dimethylurea |
|---|---|
| PubChem CID | 175137173 |
| Molecular Formula | C12H18Cl2N4O2 |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1,1-dimethylurea;1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1ccc(Cl)c(Cl)c1.CN(C)C(N)=O |
| InChI | InChI=1S/C9H10Cl2N2O.C3H8N2O/c1-13(2)9(14)12-6-3-4-7(10)8(11)5-6;1-5(2)3(4)6/h3-5H,1-2H3,(H,12,14);1-2H3,(H2,4,6) |
| InChIKey | PLTICLOJXKTHLU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |