C9H12ClN3O — CID 79154275
3-(3-amino-4-chlorophenyl)-1,1-dimethylurea (PubChem CID 79154275) has the molecular formula C9H12ClN3O and a molecular weight of 213.67 g/mol. Its IUPAC name is 3-(3-amino-4-chlorophenyl)-1,1-dimethylurea.
| Compound Name | 3-(3-amino-4-chlorophenyl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 79154275 |
| Molecular Formula | C9H12ClN3O |
| Molecular Weight | 213.67 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 3-(3-amino-4-chlorophenyl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C9H12ClN3O/c1-13(2)9(14)12-6-3-4-7(10)8(11)5-6/h3-5H,11H2,1-2H3,(H,12,14) |
| InChIKey | MVCUTHDQTOJPJE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.67 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|