C10H15N3O2 — CID 79154526
3-(4-amino-3-methoxyphenyl)-1,1-dimethylurea (PubChem CID 79154526) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 3-(4-amino-3-methoxyphenyl)-1,1-dimethylurea.
| Compound Name | 3-(4-amino-3-methoxyphenyl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 79154526 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 3-(4-amino-3-methoxyphenyl)-1,1-dimethylurea |
| SMILES | COc1cc(NC(=O)N(C)C)ccc1N |
| InChI | InChI=1S/C10H15N3O2/c1-13(2)10(14)12-7-4-5-8(11)9(6-7)15-3/h4-6H,11H2,1-3H3,(H,12,14) |
| InChIKey | ATJVLRQFVVEVCZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|