C14H22ClN3O — CID 63982422
N-(3-amino-4-chlorophenyl)-2-[methyl(2-methylbutan-2-yl)amino]acetamide (PubChem CID 63982422) has the molecular formula C14H22ClN3O and a molecular weight of 283.80 g/mol. Its IUPAC name is N-(3-amino-4-chlorophenyl)-2-[methyl(2-methylbutan-2-yl)amino]acetamide.
| Compound Name | N-(3-amino-4-chlorophenyl)-2-[methyl(2-methylbutan-2-yl)amino]acetamide |
|---|---|
| PubChem CID | 63982422 |
| Molecular Formula | C14H22ClN3O |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-(3-amino-4-chlorophenyl)-2-[methyl(2-methylbutan-2-yl)amino]acetamide |
| SMILES | CCC(C)(C)N(C)CC(=O)Nc1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C14H22ClN3O/c1-5-14(2,3)18(4)9-13(19)17-10-6-7-11(15)12(16)8-10/h6-8H,5,9,16H2,1-4H3,(H,17,19) |
| InChIKey | VXMPJCNAXCQZBV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|