C11H14Cl2N2OS — CID 21414077
3-(3,4-dichlorophenyl)-1-methyl-1-propylsulfanylurea (PubChem CID 21414077) has the molecular formula C11H14Cl2N2OS and a molecular weight of 293.22 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-methyl-1-propylsulfanylurea.
| Compound Name | 3-(3,4-dichlorophenyl)-1-methyl-1-propylsulfanylurea |
|---|---|
| PubChem CID | 21414077 |
| Molecular Formula | C11H14Cl2N2OS |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-methyl-1-propylsulfanylurea |
| SMILES | CCCSN(C)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2N2OS/c1-3-6-17-15(2)11(16)14-8-4-5-9(12)10(13)7-8/h4-5,7H,3,6H2,1-2H3,(H,14,16) |
| InChIKey | PQORFRJFBPYIHN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|