C20H25Cl2N3O2 — CID 174814667
1-butyl-3-(3,4-dichlorophenyl)-1-methylurea;N-phenylacetamide (PubChem CID 174814667) has the molecular formula C20H25Cl2N3O2 and a molecular weight of 410.35 g/mol. Its IUPAC name is 1-butyl-3-(3,4-dichlorophenyl)-1-methylurea;N-phenylacetamide.
| Compound Name | 1-butyl-3-(3,4-dichlorophenyl)-1-methylurea;N-phenylacetamide |
|---|---|
| PubChem CID | 174814667 |
| Molecular Formula | C20H25Cl2N3O2 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 1-butyl-3-(3,4-dichlorophenyl)-1-methylurea;N-phenylacetamide |
| SMILES | CC(=O)Nc1ccccc1.CCCCN(C)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H16Cl2N2O.C8H9NO/c1-3-4-7-16(2)12(17)15-9-5-6-10(13)11(14)8-9;1-7(10)9-8-5-3-2-4-6-8/h5-6,8H,3-4,7H2,1-2H3,(H,15,17);2-6H,1H3,(H,9,10) |
| InChIKey | OKQLGQUKHUNPIT-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |