C14H18Cl2N2O3 — CID 61008817
ethyl 2-[(3,4-dichlorophenyl)carbamoyl-propylamino]acetate (PubChem CID 61008817) has the molecular formula C14H18Cl2N2O3 and a molecular weight of 333.22 g/mol. Its IUPAC name is ethyl 2-[(3,4-dichlorophenyl)carbamoyl-propylamino]acetate.
| Compound Name | ethyl 2-[(3,4-dichlorophenyl)carbamoyl-propylamino]acetate |
|---|---|
| PubChem CID | 61008817 |
| Molecular Formula | C14H18Cl2N2O3 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | ethyl 2-[(3,4-dichlorophenyl)carbamoyl-propylamino]acetate |
| SMILES | CCCN(CC(=O)OCC)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H18Cl2N2O3/c1-3-7-18(9-13(19)21-4-2)14(20)17-10-5-6-11(15)12(16)8-10/h5-6,8H,3-4,7,9H2,1-2H3,(H,17,20) |
| InChIKey | SRAUKEWXYRWRRF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |