C11H14Cl2N4O2 — CID 76929020
1-(2-amino-2-hydroxyiminoethyl)-3-(3,4-dichlorophenyl)-1-ethylurea (PubChem CID 76929020) has the molecular formula C11H14Cl2N4O2 and a molecular weight of 305.17 g/mol. Its IUPAC name is 1-(2-amino-2-hydroxyiminoethyl)-3-(3,4-dichlorophenyl)-1-ethylurea.
| Compound Name | 1-(2-amino-2-hydroxyiminoethyl)-3-(3,4-dichlorophenyl)-1-ethylurea |
|---|---|
| PubChem CID | 76929020 |
| Molecular Formula | C11H14Cl2N4O2 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 1-(2-amino-2-hydroxyiminoethyl)-3-(3,4-dichlorophenyl)-1-ethylurea |
| SMILES | CCN(CC(N)=NO)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2N4O2/c1-2-17(6-10(14)16-19)11(18)15-7-3-4-8(12)9(13)5-7/h3-5,19H,2,6H2,1H3,(H2,14,16)(H,15,18) |
| InChIKey | QVJJFHZHZFJWLO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|