C8H7Cl2N3O2 — CID 53274929
(2E)-2-amino-N-(3,4-dichlorophenyl)-2-hydroxyiminoacetamide (PubChem CID 53274929) has the molecular formula C8H7Cl2N3O2 and a molecular weight of 248.07 g/mol. Its IUPAC name is (2E)-2-amino-N-(3,4-dichlorophenyl)-2-hydroxyiminoacetamide.
| Compound Name | (2E)-2-amino-N-(3,4-dichlorophenyl)-2-hydroxyiminoacetamide |
|---|---|
| PubChem CID | 53274929 |
| Molecular Formula | C8H7Cl2N3O2 |
| Molecular Weight | 248.07 g/mol |
| Exact Mass | 246.99 |
| IUPAC Name | (2E)-2-amino-N-(3,4-dichlorophenyl)-2-hydroxyiminoacetamide |
| SMILES | N/C(=N/O)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H7Cl2N3O2/c9-5-2-1-4(3-6(5)10)12-8(14)7(11)13-15/h1-3,15H,(H2,11,13)(H,12,14) |
| InChIKey | WEHANJUKFPDDLA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.07 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|