C8H7Cl2N3OS — CID 134095672
1-carbamothioyl-3-(3,4-dichlorophenyl)urea (PubChem CID 134095672) has the molecular formula C8H7Cl2N3OS and a molecular weight of 264.14 g/mol. Its IUPAC name is 1-carbamothioyl-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-carbamothioyl-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 134095672 |
| Molecular Formula | C8H7Cl2N3OS |
| Molecular Weight | 264.14 g/mol |
| Exact Mass | 262.97 |
| IUPAC Name | 1-carbamothioyl-3-(3,4-dichlorophenyl)urea |
| SMILES | NC(=S)NC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H7Cl2N3OS/c9-5-2-1-4(3-6(5)10)12-8(14)13-7(11)15/h1-3H,(H4,11,12,13,14,15) |
| InChIKey | YCJNYJOMRWTMRY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.14 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|