C11H14Cl2N4OS — CID 110190467
1-[carbamothioyl(propan-2-yl)amino]-3-(3,4-dichlorophenyl)urea (PubChem CID 110190467) has the molecular formula C11H14Cl2N4OS and a molecular weight of 321.23 g/mol. Its IUPAC name is 1-[carbamothioyl(propan-2-yl)amino]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[carbamothioyl(propan-2-yl)amino]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 110190467 |
| Molecular Formula | C11H14Cl2N4OS |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 1-[carbamothioyl(propan-2-yl)amino]-3-(3,4-dichlorophenyl)urea |
| SMILES | CC(C)N(NC(=O)Nc1ccc(Cl)c(Cl)c1)C(N)=S |
| InChI | InChI=1S/C11H14Cl2N4OS/c1-6(2)17(10(14)19)16-11(18)15-7-3-4-8(12)9(13)5-7/h3-6H,1-2H3,(H2,14,19)(H2,15,16,18) |
| InChIKey | UVJCGGGCXVMZHG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|