C9H10Cl2N2O — CID 22690595
(2S)-2-amino-N-(3,4-dichlorophenyl)propanamide (PubChem CID 22690595) has the molecular formula C9H10Cl2N2O and a molecular weight of 233.10 g/mol. Its IUPAC name is (2S)-2-amino-N-(3,4-dichlorophenyl)propanamide.
| Compound Name | (2S)-2-amino-N-(3,4-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 22690595 |
| Molecular Formula | C9H10Cl2N2O |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | (2S)-2-amino-N-(3,4-dichlorophenyl)propanamide |
| SMILES | C[C@H](N)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2N2O/c1-5(12)9(14)13-6-2-3-7(10)8(11)4-6/h2-5H,12H2,1H3,(H,13,14)/t5-/m0/s1 |
| InChIKey | SPNZMIXKAJOZKD-YFKPBYRVSA-N |
| XLogP | 2.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |