C10H11ClN2O3 — CID 78973494
4-[[(2R)-2-aminopropanoyl]amino]-2-chlorobenzoic acid (PubChem CID 78973494) has the molecular formula C10H11ClN2O3 and a molecular weight of 242.66 g/mol. Its IUPAC name is 4-[[(2R)-2-aminopropanoyl]amino]-2-chlorobenzoic acid.
| Compound Name | 4-[[(2R)-2-aminopropanoyl]amino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 78973494 |
| Molecular Formula | C10H11ClN2O3 |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 4-[[(2R)-2-aminopropanoyl]amino]-2-chlorobenzoic acid |
| SMILES | C[C@@H](N)C(=O)Nc1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C10H11ClN2O3/c1-5(12)9(14)13-6-2-3-7(10(15)16)8(11)4-6/h2-5H,12H2,1H3,(H,13,14)(H,15,16)/t5-/m1/s1 |
| InChIKey | BNOPVAIBCPRSPB-RXMQYKEDSA-N |
| XLogP | 1.32 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |