C12H16Cl2N2O — CID 70963721
2-amino-N-(3,4-dichlorophenyl)-3,3-dimethylbutanamide (PubChem CID 70963721) has the molecular formula C12H16Cl2N2O and a molecular weight of 275.18 g/mol. Its IUPAC name is 2-amino-N-(3,4-dichlorophenyl)-3,3-dimethylbutanamide.
| Compound Name | 2-amino-N-(3,4-dichlorophenyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 70963721 |
| Molecular Formula | C12H16Cl2N2O |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2-amino-N-(3,4-dichlorophenyl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)C(N)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H16Cl2N2O/c1-12(2,3)10(15)11(17)16-7-4-5-8(13)9(14)6-7/h4-6,10H,15H2,1-3H3,(H,16,17) |
| InChIKey | SKPGPNRZPUSFQQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |