C14H18N4O — CID 103929010
(2R)-2-amino-3,3-dimethyl-N-quinoxalin-6-ylbutanamide (PubChem CID 103929010) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is (2R)-2-amino-3,3-dimethyl-N-quinoxalin-6-ylbutanamide.
| Compound Name | (2R)-2-amino-3,3-dimethyl-N-quinoxalin-6-ylbutanamide |
|---|---|
| PubChem CID | 103929010 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (2R)-2-amino-3,3-dimethyl-N-quinoxalin-6-ylbutanamide |
| SMILES | CC(C)(C)[C@@H](N)C(=O)Nc1ccc2nccnc2c1 |
| InChI | InChI=1S/C14H18N4O/c1-14(2,3)12(15)13(19)18-9-4-5-10-11(8-9)17-7-6-16-10/h4-8,12H,15H2,1-3H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | RRKJTXWHUXHYEV-LBPRGKRZSA-N |
| XLogP | 1.94 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |