C13H19BrN2O — CID 76891825
2-amino-N-(4-bromo-3-methylphenyl)-3,3-dimethylbutanamide (PubChem CID 76891825) has the molecular formula C13H19BrN2O and a molecular weight of 299.21 g/mol. Its IUPAC name is 2-amino-N-(4-bromo-3-methylphenyl)-3,3-dimethylbutanamide.
| Compound Name | 2-amino-N-(4-bromo-3-methylphenyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 76891825 |
| Molecular Formula | C13H19BrN2O |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-amino-N-(4-bromo-3-methylphenyl)-3,3-dimethylbutanamide |
| SMILES | Cc1cc(NC(=O)C(N)C(C)(C)C)ccc1Br |
| InChI | InChI=1S/C13H19BrN2O/c1-8-7-9(5-6-10(8)14)16-12(17)11(15)13(2,3)4/h5-7,11H,15H2,1-4H3,(H,16,17) |
| InChIKey | XPVQAHROBQNGJI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |