C12H18BrClN2O — CID 119670393
(2S)-2-amino-N-(3-bromophenyl)-3,3-dimethylbutanamide;hydrochloride (PubChem CID 119670393) has the molecular formula C12H18BrClN2O and a molecular weight of 321.65 g/mol. Its IUPAC name is (2S)-2-amino-N-(3-bromophenyl)-3,3-dimethylbutanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-(3-bromophenyl)-3,3-dimethylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119670393 |
| Molecular Formula | C12H18BrClN2O |
| Molecular Weight | 321.65 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | (2S)-2-amino-N-(3-bromophenyl)-3,3-dimethylbutanamide;hydrochloride |
| SMILES | CC(C)(C)[C@H](N)C(=O)Nc1cccc(Br)c1.Cl |
| InChI | InChI=1S/C12H17BrN2O.ClH/c1-12(2,3)10(14)11(16)15-9-6-4-5-8(13)7-9;/h4-7,10H,14H2,1-3H3,(H,15,16);1H/t10-;/m1./s1 |
| InChIKey | CELUWYPYINJOMC-HNCPQSOCSA-N |
| XLogP | 3.18 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.65 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |