C12H18ClN3O3 — CID 119670754
(2S)-2-amino-3,3-dimethyl-N-(3-nitrophenyl)butanamide;hydrochloride (PubChem CID 119670754) has the molecular formula C12H18ClN3O3 and a molecular weight of 287.75 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl-N-(3-nitrophenyl)butanamide;hydrochloride.
| Compound Name | (2S)-2-amino-3,3-dimethyl-N-(3-nitrophenyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119670754 |
| Molecular Formula | C12H18ClN3O3 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl-N-(3-nitrophenyl)butanamide;hydrochloride |
| SMILES | CC(C)(C)[C@H](N)C(=O)Nc1cccc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C12H17N3O3.ClH/c1-12(2,3)10(13)11(16)14-8-5-4-6-9(7-8)15(17)18;/h4-7,10H,13H2,1-3H3,(H,14,16);1H/t10-;/m1./s1 |
| InChIKey | RASMDLQXLPUQJP-HNCPQSOCSA-N |
| XLogP | 2.33 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|