C12H17N3O4 — CID 107744218
(2R)-2-amino-N-(2-hydroxy-4-nitrophenyl)-3,3-dimethylbutanamide (PubChem CID 107744218) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is (2R)-2-amino-N-(2-hydroxy-4-nitrophenyl)-3,3-dimethylbutanamide.
| Compound Name | (2R)-2-amino-N-(2-hydroxy-4-nitrophenyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 107744218 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | (2R)-2-amino-N-(2-hydroxy-4-nitrophenyl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)[C@@H](N)C(=O)Nc1ccc([N+](=O)[O-])cc1O |
| InChI | InChI=1S/C12H17N3O4/c1-12(2,3)10(13)11(17)14-8-5-4-7(15(18)19)6-9(8)16/h4-6,10,16H,13H2,1-3H3,(H,14,17)/t10-/m0/s1 |
| InChIKey | BZRMCKHWRNCAFQ-JTQLQIEISA-N |
| XLogP | 1.61 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|