C9H6F4N2O4 — CID 7285095
(2R)-2,3,3,3-tetrafluoro-N-(2-hydroxy-4-nitrophenyl)propanamide (PubChem CID 7285095) has the molecular formula C9H6F4N2O4 and a molecular weight of 282.15 g/mol. Its IUPAC name is (2R)-2,3,3,3-tetrafluoro-N-(2-hydroxy-4-nitrophenyl)propanamide.
| Compound Name | (2R)-2,3,3,3-tetrafluoro-N-(2-hydroxy-4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 7285095 |
| Molecular Formula | C9H6F4N2O4 |
| Molecular Weight | 282.15 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | (2R)-2,3,3,3-tetrafluoro-N-(2-hydroxy-4-nitrophenyl)propanamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1O)[C@@H](F)C(F)(F)F |
| InChI | InChI=1S/C9H6F4N2O4/c10-7(9(11,12)13)8(17)14-5-2-1-4(15(18)19)3-6(5)16/h1-3,7,16H,(H,14,17)/t7-/m1/s1 |
| InChIKey | VCBHTQKIGRKGIB-SSDOTTSWSA-N |
| XLogP | 2.14 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.15 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|