C13H9F2N3O4 — CID 46226805
1-(3,4-difluorophenyl)-3-(2-hydroxy-4-nitrophenyl)urea (PubChem CID 46226805) has the molecular formula C13H9F2N3O4 and a molecular weight of 309.23 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-(2-hydroxy-4-nitrophenyl)urea.
| Compound Name | 1-(3,4-difluorophenyl)-3-(2-hydroxy-4-nitrophenyl)urea |
|---|---|
| PubChem CID | 46226805 |
| Molecular Formula | C13H9F2N3O4 |
| Molecular Weight | 309.23 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-(2-hydroxy-4-nitrophenyl)urea |
| SMILES | O=C(Nc1ccc(F)c(F)c1)Nc1ccc([N+](=O)[O-])cc1O |
| InChI | InChI=1S/C13H9F2N3O4/c14-9-3-1-7(5-10(9)15)16-13(20)17-11-4-2-8(18(21)22)6-12(11)19/h1-6,19H,(H2,16,17,20) |
| InChIKey | BTDULWMVDJUWBE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|